C24H26N6O3S — CID 91250392
N-[3-[2-(4-morpholin-4-ylanilino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]ethanesulfonamide (PubChem CID 91250392) has the molecular formula C24H26N6O3S and a molecular weight of 478.58 g/mol. Its IUPAC name is N-[3-[2-(4-morpholin-4-ylanilino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]ethanesulfonamide.
| Compound Name | N-[3-[2-(4-morpholin-4-ylanilino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 91250392 |
| Molecular Formula | C24H26N6O3S |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | N-[3-[2-(4-morpholin-4-ylanilino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1cccc(-c2ccc3cnc(Nc4ccc(N5CCOCC5)cc4)nn23)c1 |
| InChI | InChI=1S/C24H26N6O3S/c1-2-34(31,32)28-20-5-3-4-18(16-20)23-11-10-22-17-25-24(27-30(22)23)26-19-6-8-21(9-7-19)29-12-14-33-15-13-29/h3-11,16-17,28H,2,12-15H2,1H3,(H,26,27) |
| InChIKey | NYWATUTWBMQHOG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 100.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|