C26H28N6O4S — CID 66710898
N-(2-methylsulfonylethyl)-4-[2-(4-morpholin-4-ylanilino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]benzamide (PubChem CID 66710898) has the molecular formula C26H28N6O4S and a molecular weight of 520.62 g/mol. Its IUPAC name is N-(2-methylsulfonylethyl)-4-[2-(4-morpholin-4-ylanilino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]benzamide.
| Compound Name | N-(2-methylsulfonylethyl)-4-[2-(4-morpholin-4-ylanilino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]benzamide |
|---|---|
| PubChem CID | 66710898 |
| Molecular Formula | C26H28N6O4S |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | N-(2-methylsulfonylethyl)-4-[2-(4-morpholin-4-ylanilino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]benzamide |
| SMILES | CS(=O)(=O)CCNC(=O)c1ccc(-c2ccc3cnc(Nc4ccc(N5CCOCC5)cc4)nn23)cc1 |
| InChI | InChI=1S/C26H28N6O4S/c1-37(34,35)17-12-27-25(33)20-4-2-19(3-5-20)24-11-10-23-18-28-26(30-32(23)24)29-21-6-8-22(9-7-21)31-13-15-36-16-14-31/h2-11,18H,12-17H2,1H3,(H,27,33)(H,29,30) |
| InChIKey | GWKKCMJLCJUGNP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 117.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|