C25H27N5O3S — CID 66711114
[1-[4-[[7-(3-methylsulfonylphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]piperidin-4-yl]methanol (PubChem CID 66711114) has the molecular formula C25H27N5O3S and a molecular weight of 477.59 g/mol. Its IUPAC name is [1-[4-[[7-(3-methylsulfonylphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]piperidin-4-yl]methanol.
| Compound Name | [1-[4-[[7-(3-methylsulfonylphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 66711114 |
| Molecular Formula | C25H27N5O3S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | [1-[4-[[7-(3-methylsulfonylphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]piperidin-4-yl]methanol |
| SMILES | CS(=O)(=O)c1cccc(-c2ccc3cnc(Nc4ccc(N5CCC(CO)CC5)cc4)nn23)c1 |
| InChI | InChI=1S/C25H27N5O3S/c1-34(32,33)23-4-2-3-19(15-23)24-10-9-22-16-26-25(28-30(22)24)27-20-5-7-21(8-6-20)29-13-11-18(17-31)12-14-29/h2-10,15-16,18,31H,11-14,17H2,1H3,(H,27,28) |
| InChIKey | XDFIPVACTDAFAI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 99.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|