C28H34N6O2S — CID 66711665
N-[4-[4-(diethylamino)piperidin-1-yl]phenyl]-7-(4-methylsulfonylphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 66711665) has the molecular formula C28H34N6O2S and a molecular weight of 518.69 g/mol. Its IUPAC name is N-[4-[4-(diethylamino)piperidin-1-yl]phenyl]-7-(4-methylsulfonylphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | N-[4-[4-(diethylamino)piperidin-1-yl]phenyl]-7-(4-methylsulfonylphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 66711665 |
| Molecular Formula | C28H34N6O2S |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | N-[4-[4-(diethylamino)piperidin-1-yl]phenyl]-7-(4-methylsulfonylphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | CCN(CC)C1CCN(c2ccc(Nc3ncc4ccc(-c5ccc(S(C)(=O)=O)cc5)n4n3)cc2)CC1 |
| InChI | InChI=1S/C28H34N6O2S/c1-4-32(5-2)24-16-18-33(19-17-24)23-10-8-22(9-11-23)30-28-29-20-25-12-15-27(34(25)31-28)21-6-13-26(14-7-21)37(3,35)36/h6-15,20,24H,4-5,16-19H2,1-3H3,(H,30,31) |
| InChIKey | QTEXTGNPVRXHTI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 82.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|