C24H25FN6O2S — CID 66711917
N-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]-7-(4-methylsulfonylphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 66711917) has the molecular formula C24H25FN6O2S and a molecular weight of 480.57 g/mol. Its IUPAC name is N-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]-7-(4-methylsulfonylphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | N-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]-7-(4-methylsulfonylphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 66711917 |
| Molecular Formula | C24H25FN6O2S |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | N-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]-7-(4-methylsulfonylphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3ncc4ccc(-c5ccc(S(C)(=O)=O)cc5)n4n3)cc2F)CC1 |
| InChI | InChI=1S/C24H25FN6O2S/c1-29-11-13-30(14-12-29)23-9-5-18(15-21(23)25)27-24-26-16-19-6-10-22(31(19)28-24)17-3-7-20(8-4-17)34(2,32)33/h3-10,15-16H,11-14H2,1-2H3,(H,27,28) |
| InChIKey | HZSRTCFHNSVMHE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 82.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|