C27H32N8 — CID 66712093
N-[4-(4-methylpiperazin-1-yl)phenyl]-7-(3-piperazin-1-ylphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 66712093) has the molecular formula C27H32N8 and a molecular weight of 468.61 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-7-(3-piperazin-1-ylphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-7-(3-piperazin-1-ylphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 66712093 |
| Molecular Formula | C27H32N8 |
| Molecular Weight | 468.61 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-7-(3-piperazin-1-ylphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3ncc4ccc(-c5cccc(N6CCNCC6)c5)n4n3)cc2)CC1 |
| InChI | InChI=1S/C27H32N8/c1-32-15-17-34(18-16-32)23-7-5-22(6-8-23)30-27-29-20-25-9-10-26(35(25)31-27)21-3-2-4-24(19-21)33-13-11-28-12-14-33/h2-10,19-20,28H,11-18H2,1H3,(H,30,31) |
| InChIKey | UNWYXOJDLYLGFT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.61 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|