C24H24N6O2 — CID 66712335
2-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]benzoic acid (PubChem CID 66712335) has the molecular formula C24H24N6O2 and a molecular weight of 428.50 g/mol. Its IUPAC name is 2-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]benzoic acid.
| Compound Name | 2-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]benzoic acid |
|---|---|
| PubChem CID | 66712335 |
| Molecular Formula | C24H24N6O2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 2-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]benzoic acid |
| SMILES | CN1CCN(c2ccc(Nc3ncc4ccc(-c5ccccc5C(=O)O)n4n3)cc2)CC1 |
| InChI | InChI=1S/C24H24N6O2/c1-28-12-14-29(15-13-28)18-8-6-17(7-9-18)26-24-25-16-19-10-11-22(30(19)27-24)20-4-2-3-5-21(20)23(31)32/h2-11,16H,12-15H2,1H3,(H,26,27)(H,31,32) |
| InChIKey | QORKWERBLUZQLN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 86.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|