C28H32N6O2 — CID 66712403
tert-butyl 3-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]benzoate (PubChem CID 66712403) has the molecular formula C28H32N6O2 and a molecular weight of 484.60 g/mol. Its IUPAC name is tert-butyl 3-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]benzoate.
| Compound Name | tert-butyl 3-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]benzoate |
|---|---|
| PubChem CID | 66712403 |
| Molecular Formula | C28H32N6O2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | tert-butyl 3-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]benzoate |
| SMILES | CN1CCN(c2ccc(Nc3ncc4ccc(-c5cccc(C(=O)OC(C)(C)C)c5)n4n3)cc2)CC1 |
| InChI | InChI=1S/C28H32N6O2/c1-28(2,3)36-26(35)21-7-5-6-20(18-21)25-13-12-24-19-29-27(31-34(24)25)30-22-8-10-23(11-9-22)33-16-14-32(4)15-17-33/h5-13,18-19H,14-17H2,1-4H3,(H,30,31) |
| InChIKey | SRLNDOFARLGYFQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|