C23H24N6 — CID 46220497
N-[4-(4-methylpiperazin-1-yl)phenyl]-7-phenylpyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 46220497) has the molecular formula C23H24N6 and a molecular weight of 384.49 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-7-phenylpyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-7-phenylpyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 46220497 |
| Molecular Formula | C23H24N6 |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-7-phenylpyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3ncc4ccc(-c5ccccc5)n4n3)cc2)CC1 |
| InChI | InChI=1S/C23H24N6/c1-27-13-15-28(16-14-27)20-9-7-19(8-10-20)25-23-24-17-21-11-12-22(29(21)26-23)18-5-3-2-4-6-18/h2-12,17H,13-16H2,1H3,(H,25,26) |
| InChIKey | DYLDSHGJNKWVDU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 48.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|