C27H30F3N7O4S — CID 54578550
N-methyl-N-[2-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]methanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 54578550) has the molecular formula C27H30F3N7O4S and a molecular weight of 605.64 g/mol. Its IUPAC name is N-methyl-N-[2-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]methanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-methyl-N-[2-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 54578550 |
| Molecular Formula | C27H30F3N7O4S |
| Molecular Weight | 605.64 g/mol |
| Exact Mass | 605.20 |
| IUPAC Name | N-methyl-N-[2-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CN1CCN(c2ccc(Nc3ncc4ccc(-c5ccccc5N(C)S(C)(=O)=O)n4n3)cc2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H29N7O2S.C2HF3O2/c1-29-14-16-31(17-15-29)20-10-8-19(9-11-20)27-25-26-18-21-12-13-24(32(21)28-25)22-6-4-5-7-23(22)30(2)35(3,33)34;3-2(4,5)1(6)7/h4-13,18H,14-17H2,1-3H3,(H,27,28);(H,6,7) |
| InChIKey | LGBRWWBONIQSII-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.64 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|