C25H26N6O3 — CID 66712091
2-[2-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenoxy]acetic acid (PubChem CID 66712091) has the molecular formula C25H26N6O3 and a molecular weight of 458.52 g/mol. Its IUPAC name is 2-[2-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenoxy]acetic acid.
| Compound Name | 2-[2-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 66712091 |
| Molecular Formula | C25H26N6O3 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 2-[2-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenoxy]acetic acid |
| SMILES | CN1CCN(c2ccc(Nc3ncc4ccc(-c5ccccc5OCC(=O)O)n4n3)cc2)CC1 |
| InChI | InChI=1S/C25H26N6O3/c1-29-12-14-30(15-13-29)19-8-6-18(7-9-19)27-25-26-16-20-10-11-22(31(20)28-25)21-4-2-3-5-23(21)34-17-24(32)33/h2-11,16H,12-15,17H2,1H3,(H,27,28)(H,32,33) |
| InChIKey | SQJSKKWFFIHYSE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|