C24H22N6O2 — CID 66712286
2-[2-[2-(4-morpholin-4-ylanilino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenoxy]acetonitrile (PubChem CID 66712286) has the molecular formula C24H22N6O2 and a molecular weight of 426.48 g/mol. Its IUPAC name is 2-[2-[2-(4-morpholin-4-ylanilino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenoxy]acetonitrile.
| Compound Name | 2-[2-[2-(4-morpholin-4-ylanilino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 66712286 |
| Molecular Formula | C24H22N6O2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 2-[2-[2-(4-morpholin-4-ylanilino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenoxy]acetonitrile |
| SMILES | N#CCOc1ccccc1-c1ccc2cnc(Nc3ccc(N4CCOCC4)cc3)nn12 |
| InChI | InChI=1S/C24H22N6O2/c25-11-14-32-23-4-2-1-3-21(23)22-10-9-20-17-26-24(28-30(20)22)27-18-5-7-19(8-6-18)29-12-15-31-16-13-29/h1-10,17H,12-16H2,(H,27,28) |
| InChIKey | FCASTVMHZHJZRZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|