C25H25N7O — CID 66712324
2-[2-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-6-yl]phenoxy]acetonitrile (PubChem CID 66712324) has the molecular formula C25H25N7O and a molecular weight of 439.52 g/mol. Its IUPAC name is 2-[2-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-6-yl]phenoxy]acetonitrile.
| Compound Name | 2-[2-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-6-yl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 66712324 |
| Molecular Formula | C25H25N7O |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 2-[2-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-6-yl]phenoxy]acetonitrile |
| SMILES | CN1CCN(c2ccc(Nc3ncc4cc(-c5ccccc5OCC#N)cn4n3)cc2)CC1 |
| InChI | InChI=1S/C25H25N7O/c1-30-11-13-31(14-12-30)21-8-6-20(7-9-21)28-25-27-17-22-16-19(18-32(22)29-25)23-4-2-3-5-24(23)33-15-10-26/h2-9,16-18H,11-15H2,1H3,(H,28,29) |
| InChIKey | WSKUXHVTLKKSQK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 81.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|