C20H19N5O — CID 66710560
N-(4-morpholin-4-ylphenyl)-[1,2,4]triazino[1,6-a]indol-2-amine (PubChem CID 66710560) has the molecular formula C20H19N5O and a molecular weight of 345.41 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-[1,2,4]triazino[1,6-a]indol-2-amine.
| Compound Name | N-(4-morpholin-4-ylphenyl)-[1,2,4]triazino[1,6-a]indol-2-amine |
|---|---|
| PubChem CID | 66710560 |
| Molecular Formula | C20H19N5O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-[1,2,4]triazino[1,6-a]indol-2-amine |
| SMILES | c1ccc2c(c1)cc1cnc(Nc3ccc(N4CCOCC4)cc3)nn12 |
| InChI | InChI=1S/C20H19N5O/c1-2-4-19-15(3-1)13-18-14-21-20(23-25(18)19)22-16-5-7-17(8-6-16)24-9-11-26-12-10-24/h1-8,13-14H,9-12H2,(H,22,23) |
| InChIKey | QEIVANSRSROKMF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 54.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|