C26H30N6O3S — CID 66712724
7-[3-[(2-methylsulfonylethylamino)methyl]phenyl]-N-(4-morpholin-4-ylphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 66712724) has the molecular formula C26H30N6O3S and a molecular weight of 506.63 g/mol. Its IUPAC name is 7-[3-[(2-methylsulfonylethylamino)methyl]phenyl]-N-(4-morpholin-4-ylphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | 7-[3-[(2-methylsulfonylethylamino)methyl]phenyl]-N-(4-morpholin-4-ylphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 66712724 |
| Molecular Formula | C26H30N6O3S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | 7-[3-[(2-methylsulfonylethylamino)methyl]phenyl]-N-(4-morpholin-4-ylphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | CS(=O)(=O)CCNCc1cccc(-c2ccc3cnc(Nc4ccc(N5CCOCC5)cc4)nn23)c1 |
| InChI | InChI=1S/C26H30N6O3S/c1-36(33,34)16-11-27-18-20-3-2-4-21(17-20)25-10-9-24-19-28-26(30-32(24)25)29-22-5-7-23(8-6-22)31-12-14-35-15-13-31/h2-10,17,19,27H,11-16,18H2,1H3,(H,29,30) |
| InChIKey | OYXXOOTWPXJFPT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 100.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|