C24H24ClN5O — CID 66712747
[1-[4-[[7-(3-chlorophenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]piperidin-4-yl]methanol (PubChem CID 66712747) has the molecular formula C24H24ClN5O and a molecular weight of 433.94 g/mol. Its IUPAC name is [1-[4-[[7-(3-chlorophenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]piperidin-4-yl]methanol.
| Compound Name | [1-[4-[[7-(3-chlorophenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 66712747 |
| Molecular Formula | C24H24ClN5O |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | [1-[4-[[7-(3-chlorophenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]amino]phenyl]piperidin-4-yl]methanol |
| SMILES | OCC1CCN(c2ccc(Nc3ncc4ccc(-c5cccc(Cl)c5)n4n3)cc2)CC1 |
| InChI | InChI=1S/C24H24ClN5O/c25-19-3-1-2-18(14-19)23-9-8-22-15-26-24(28-30(22)23)27-20-4-6-21(7-5-20)29-12-10-17(16-31)11-13-29/h1-9,14-15,17,31H,10-13,16H2,(H,27,28) |
| InChIKey | CFRJTLNGTGYKRC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 65.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|