C19H13ClN4O2 — CID 87399201
N-(3H-1,2-benzodioxol-5-yl)-7-(3-chlorophenyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 87399201) has the molecular formula C19H13ClN4O2 and a molecular weight of 364.79 g/mol. Its IUPAC name is N-(3H-1,2-benzodioxol-5-yl)-7-(3-chlorophenyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | N-(3H-1,2-benzodioxol-5-yl)-7-(3-chlorophenyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 87399201 |
| Molecular Formula | C19H13ClN4O2 |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | N-(3H-1,2-benzodioxol-5-yl)-7-(3-chlorophenyl)pyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | Clc1cccc(-c2ccc3cnc(Nc4ccc5c(c4)COO5)nn23)c1 |
| InChI | InChI=1S/C19H13ClN4O2/c20-14-3-1-2-12(8-14)17-6-5-16-10-21-19(23-24(16)17)22-15-4-7-18-13(9-15)11-25-26-18/h1-10H,11H2,(H,22,23) |
| InChIKey | WYCJNDSPOVCBIW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|