C36H38FN5O3 — CID 158230179
1-[3-fluoro-5-[2-(4-hydroxy-3-piperidin-1-ylanilino)-5-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]phenyl]but-3-en-2-one (PubChem CID 158230179) has the molecular formula C36H38FN5O3 and a molecular weight of 607.73 g/mol. Its IUPAC name is 1-[3-fluoro-5-[2-(4-hydroxy-3-piperidin-1-ylanilino)-5-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]phenyl]but-3-en-2-one.
| Compound Name | 1-[3-fluoro-5-[2-(4-hydroxy-3-piperidin-1-ylanilino)-5-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 158230179 |
| Molecular Formula | C36H38FN5O3 |
| Molecular Weight | 607.73 g/mol |
| Exact Mass | 607.30 |
| IUPAC Name | 1-[3-fluoro-5-[2-(4-hydroxy-3-piperidin-1-ylanilino)-5-[(4-morpholin-4-ylphenyl)methyl]pyrimidin-4-yl]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cc(F)cc(-c2nc(Nc3ccc(O)c(N4CCCCC4)c3)ncc2Cc2ccc(N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C36H38FN5O3/c1-2-32(43)21-26-19-27(22-29(37)20-26)35-28(18-25-6-9-31(10-7-25)41-14-16-45-17-15-41)24-38-36(40-35)39-30-8-11-34(44)33(23-30)42-12-4-3-5-13-42/h2,6-11,19-20,22-24,44H,1,3-5,12-18,21H2,(H,38,39,40) |
| InChIKey | NEZMADYIPQQYTB-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.73 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|