C26H26F2N4O2 — CID 158706413
1-[3-fluoro-5-[5-fluoro-2-(4-methoxy-3-piperidin-1-ylanilino)pyrimidin-4-yl]phenyl]but-3-en-2-one (PubChem CID 158706413) has the molecular formula C26H26F2N4O2 and a molecular weight of 464.52 g/mol. Its IUPAC name is 1-[3-fluoro-5-[5-fluoro-2-(4-methoxy-3-piperidin-1-ylanilino)pyrimidin-4-yl]phenyl]but-3-en-2-one.
| Compound Name | 1-[3-fluoro-5-[5-fluoro-2-(4-methoxy-3-piperidin-1-ylanilino)pyrimidin-4-yl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 158706413 |
| Molecular Formula | C26H26F2N4O2 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 1-[3-fluoro-5-[5-fluoro-2-(4-methoxy-3-piperidin-1-ylanilino)pyrimidin-4-yl]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cc(F)cc(-c2nc(Nc3ccc(OC)c(N4CCCCC4)c3)ncc2F)c1 |
| InChI | InChI=1S/C26H26F2N4O2/c1-3-21(33)13-17-11-18(14-19(27)12-17)25-22(28)16-29-26(31-25)30-20-7-8-24(34-2)23(15-20)32-9-5-4-6-10-32/h3,7-8,11-12,14-16H,1,4-6,9-10,13H2,2H3,(H,29,30,31) |
| InChIKey | KUPCMSCQEOQRSF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|