C26H26F2N4O — CID 159141230
1-[2-fluoro-5-[2-(4-fluoro-3-piperidin-1-ylanilino)-5-methylpyrimidin-4-yl]phenyl]but-3-en-2-one (PubChem CID 159141230) has the molecular formula C26H26F2N4O and a molecular weight of 448.52 g/mol. Its IUPAC name is 1-[2-fluoro-5-[2-(4-fluoro-3-piperidin-1-ylanilino)-5-methylpyrimidin-4-yl]phenyl]but-3-en-2-one.
| Compound Name | 1-[2-fluoro-5-[2-(4-fluoro-3-piperidin-1-ylanilino)-5-methylpyrimidin-4-yl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 159141230 |
| Molecular Formula | C26H26F2N4O |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 1-[2-fluoro-5-[2-(4-fluoro-3-piperidin-1-ylanilino)-5-methylpyrimidin-4-yl]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cc(-c2nc(Nc3ccc(F)c(N4CCCCC4)c3)ncc2C)ccc1F |
| InChI | InChI=1S/C26H26F2N4O/c1-3-21(33)14-19-13-18(7-9-22(19)27)25-17(2)16-29-26(31-25)30-20-8-10-23(28)24(15-20)32-11-5-4-6-12-32/h3,7-10,13,15-16H,1,4-6,11-12,14H2,2H3,(H,29,30,31) |
| InChIKey | KTKWBFDPCFPVSG-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|