C25H24Cl2N4O — CID 158025454
1-[2-chloro-5-[5-chloro-2-(3-piperidin-1-ylanilino)pyrimidin-4-yl]phenyl]but-3-en-2-one (PubChem CID 158025454) has the molecular formula C25H24Cl2N4O and a molecular weight of 467.40 g/mol. Its IUPAC name is 1-[2-chloro-5-[5-chloro-2-(3-piperidin-1-ylanilino)pyrimidin-4-yl]phenyl]but-3-en-2-one.
| Compound Name | 1-[2-chloro-5-[5-chloro-2-(3-piperidin-1-ylanilino)pyrimidin-4-yl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 158025454 |
| Molecular Formula | C25H24Cl2N4O |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 1-[2-chloro-5-[5-chloro-2-(3-piperidin-1-ylanilino)pyrimidin-4-yl]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cc(-c2nc(Nc3cccc(N4CCCCC4)c3)ncc2Cl)ccc1Cl |
| InChI | InChI=1S/C25H24Cl2N4O/c1-2-21(32)14-18-13-17(9-10-22(18)26)24-23(27)16-28-25(30-24)29-19-7-6-8-20(15-19)31-11-4-3-5-12-31/h2,6-10,13,15-16H,1,3-5,11-12,14H2,(H,28,29,30) |
| InChIKey | NQSMUHXKNOWOPO-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|