C32H30ClFN4O — CID 159991280
1-[2-chloro-5-[5-[(3-fluorophenyl)methyl]-2-(3-piperidin-1-ylanilino)pyrimidin-4-yl]phenyl]but-3-en-2-one (PubChem CID 159991280) has the molecular formula C32H30ClFN4O and a molecular weight of 541.07 g/mol. Its IUPAC name is 1-[2-chloro-5-[5-[(3-fluorophenyl)methyl]-2-(3-piperidin-1-ylanilino)pyrimidin-4-yl]phenyl]but-3-en-2-one.
| Compound Name | 1-[2-chloro-5-[5-[(3-fluorophenyl)methyl]-2-(3-piperidin-1-ylanilino)pyrimidin-4-yl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 159991280 |
| Molecular Formula | C32H30ClFN4O |
| Molecular Weight | 541.07 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 1-[2-chloro-5-[5-[(3-fluorophenyl)methyl]-2-(3-piperidin-1-ylanilino)pyrimidin-4-yl]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cc(-c2nc(Nc3cccc(N4CCCCC4)c3)ncc2Cc2cccc(F)c2)ccc1Cl |
| InChI | InChI=1S/C32H30ClFN4O/c1-2-29(39)19-24-18-23(12-13-30(24)33)31-25(16-22-8-6-9-26(34)17-22)21-35-32(37-31)36-27-10-7-11-28(20-27)38-14-4-3-5-15-38/h2,6-13,17-18,20-21H,1,3-5,14-16,19H2,(H,35,36,37) |
| InChIKey | ZTCQCYMIRBCZMS-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.07 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|