C26H24ClN5O — CID 157338088
1-[3-[2-(4-chloro-3-piperidin-1-ylanilino)-5-isocyanopyrimidin-4-yl]phenyl]but-3-en-2-one (PubChem CID 157338088) has the molecular formula C26H24ClN5O and a molecular weight of 457.97 g/mol. Its IUPAC name is 1-[3-[2-(4-chloro-3-piperidin-1-ylanilino)-5-isocyanopyrimidin-4-yl]phenyl]but-3-en-2-one.
| Compound Name | 1-[3-[2-(4-chloro-3-piperidin-1-ylanilino)-5-isocyanopyrimidin-4-yl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 157338088 |
| Molecular Formula | C26H24ClN5O |
| Molecular Weight | 457.97 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 1-[3-[2-(4-chloro-3-piperidin-1-ylanilino)-5-isocyanopyrimidin-4-yl]phenyl]but-3-en-2-one |
| SMILES | [C-]#[N+]c1cnc(Nc2ccc(Cl)c(N3CCCCC3)c2)nc1-c1cccc(CC(=O)C=C)c1 |
| InChI | InChI=1S/C26H24ClN5O/c1-3-21(33)15-18-8-7-9-19(14-18)25-23(28-2)17-29-26(31-25)30-20-10-11-22(27)24(16-20)32-12-5-4-6-13-32/h3,7-11,14,16-17H,1,4-6,12-13,15H2,(H,29,30,31) |
| InChIKey | NOBXYIOENUVWIS-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.97 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|