C26H25N5O — CID 160714945
1-[3-[6-isocyano-2-(3-piperidin-1-ylanilino)pyrimidin-4-yl]phenyl]but-3-en-2-one (PubChem CID 160714945) has the molecular formula C26H25N5O and a molecular weight of 423.52 g/mol. Its IUPAC name is 1-[3-[6-isocyano-2-(3-piperidin-1-ylanilino)pyrimidin-4-yl]phenyl]but-3-en-2-one.
| Compound Name | 1-[3-[6-isocyano-2-(3-piperidin-1-ylanilino)pyrimidin-4-yl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 160714945 |
| Molecular Formula | C26H25N5O |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 1-[3-[6-isocyano-2-(3-piperidin-1-ylanilino)pyrimidin-4-yl]phenyl]but-3-en-2-one |
| SMILES | [C-]#[N+]c1cc(-c2cccc(CC(=O)C=C)c2)nc(Nc2cccc(N3CCCCC3)c2)n1 |
| InChI | InChI=1S/C26H25N5O/c1-3-23(32)16-19-9-7-10-20(15-19)24-18-25(27-2)30-26(29-24)28-21-11-8-12-22(17-21)31-13-5-4-6-14-31/h3,7-12,15,17-18H,1,4-6,13-14,16H2,(H,28,29,30) |
| InChIKey | KKUXMRZBODJGHP-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|