C27H26N8O — CID 158068205
1-[3-[3-isocyano-6-[3-(4-methylpiperazin-1-yl)anilino]-2H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one (PubChem CID 158068205) has the molecular formula C27H26N8O and a molecular weight of 478.56 g/mol. Its IUPAC name is 1-[3-[3-isocyano-6-[3-(4-methylpiperazin-1-yl)anilino]-2H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one.
| Compound Name | 1-[3-[3-isocyano-6-[3-(4-methylpiperazin-1-yl)anilino]-2H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 158068205 |
| Molecular Formula | C27H26N8O |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | 1-[3-[3-isocyano-6-[3-(4-methylpiperazin-1-yl)anilino]-2H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one |
| SMILES | [C-]#[N+]c1[nH]nc2nc(Nc3cccc(N4CCN(C)CC4)c3)nc(-c3cccc(CC(=O)C=C)c3)c12 |
| InChI | InChI=1S/C27H26N8O/c1-4-22(36)16-18-7-5-8-19(15-18)24-23-25(28-2)32-33-26(23)31-27(30-24)29-20-9-6-10-21(17-20)35-13-11-34(3)12-14-35/h4-10,15,17H,1,11-14,16H2,3H3,(H2,29,30,31,32,33) |
| InChIKey | RQXPKZQYHDKDOF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|