C27H29N7O2 — CID 159875120
1-[4-methoxy-3-[6-[3-(4-methylpiperazin-1-yl)anilino]-1H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one (PubChem CID 159875120) has the molecular formula C27H29N7O2 and a molecular weight of 483.58 g/mol. Its IUPAC name is 1-[4-methoxy-3-[6-[3-(4-methylpiperazin-1-yl)anilino]-1H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one.
| Compound Name | 1-[4-methoxy-3-[6-[3-(4-methylpiperazin-1-yl)anilino]-1H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 159875120 |
| Molecular Formula | C27H29N7O2 |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 1-[4-methoxy-3-[6-[3-(4-methylpiperazin-1-yl)anilino]-1H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1ccc(OC)c(-c2nc(Nc3cccc(N4CCN(C)CC4)c3)nc3[nH]ncc23)c1 |
| InChI | InChI=1S/C27H29N7O2/c1-4-21(35)14-18-8-9-24(36-3)22(15-18)25-23-17-28-32-26(23)31-27(30-25)29-19-6-5-7-20(16-19)34-12-10-33(2)11-13-34/h4-9,15-17H,1,10-14H2,2-3H3,(H2,28,29,30,31,32) |
| InChIKey | QECVOFPVUHHDNF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|