C26H26FN7O — CID 158068202
1-[3-[3-fluoro-6-[3-(4-methylpiperazin-1-yl)anilino]-2H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one (PubChem CID 158068202) has the molecular formula C26H26FN7O and a molecular weight of 471.54 g/mol. Its IUPAC name is 1-[3-[3-fluoro-6-[3-(4-methylpiperazin-1-yl)anilino]-2H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one.
| Compound Name | 1-[3-[3-fluoro-6-[3-(4-methylpiperazin-1-yl)anilino]-2H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 158068202 |
| Molecular Formula | C26H26FN7O |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 1-[3-[3-fluoro-6-[3-(4-methylpiperazin-1-yl)anilino]-2H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cccc(-c2nc(Nc3cccc(N4CCN(C)CC4)c3)nc3n[nH]c(F)c23)c1 |
| InChI | InChI=1S/C26H26FN7O/c1-3-21(35)15-17-6-4-7-18(14-17)23-22-24(27)31-32-25(22)30-26(29-23)28-19-8-5-9-20(16-19)34-12-10-33(2)11-13-34/h3-9,14,16H,1,10-13,15H2,2H3,(H2,28,29,30,31,32) |
| InChIKey | VJALIEVGLKXNLG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|