C24H25ClN6O — CID 118354491
N-[3-[5-chloro-2-[3-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]phenyl]prop-2-enamide (PubChem CID 118354491) has the molecular formula C24H25ClN6O and a molecular weight of 448.96 g/mol. Its IUPAC name is N-[3-[5-chloro-2-[3-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[5-chloro-2-[3-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118354491 |
| Molecular Formula | C24H25ClN6O |
| Molecular Weight | 448.96 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | N-[3-[5-chloro-2-[3-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2nc(Nc3cccc(N4CCN(C)CC4)c3)ncc2Cl)c1 |
| InChI | InChI=1S/C24H25ClN6O/c1-3-22(32)27-18-7-4-6-17(14-18)23-21(25)16-26-24(29-23)28-19-8-5-9-20(15-19)31-12-10-30(2)11-13-31/h3-9,14-16H,1,10-13H2,2H3,(H,27,32)(H,26,28,29) |
| InChIKey | AZIQDLCGMMUYSQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.96 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|