C25H25F3N6O2 — CID 118361564
N-[3-[2-[3-(4-methylpiperazin-1-yl)anilino]-6-(trifluoromethoxy)pyrimidin-4-yl]phenyl]prop-2-enamide (PubChem CID 118361564) has the molecular formula C25H25F3N6O2 and a molecular weight of 498.51 g/mol. Its IUPAC name is N-[3-[2-[3-(4-methylpiperazin-1-yl)anilino]-6-(trifluoromethoxy)pyrimidin-4-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[2-[3-(4-methylpiperazin-1-yl)anilino]-6-(trifluoromethoxy)pyrimidin-4-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118361564 |
| Molecular Formula | C25H25F3N6O2 |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | N-[3-[2-[3-(4-methylpiperazin-1-yl)anilino]-6-(trifluoromethoxy)pyrimidin-4-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2cc(OC(F)(F)F)nc(Nc3cccc(N4CCN(C)CC4)c3)n2)c1 |
| InChI | InChI=1S/C25H25F3N6O2/c1-3-22(35)29-18-7-4-6-17(14-18)21-16-23(36-25(26,27)28)32-24(31-21)30-19-8-5-9-20(15-19)34-12-10-33(2)11-13-34/h3-9,14-16H,1,10-13H2,2H3,(H,29,35)(H,30,31,32) |
| InChIKey | ODCLZESOKZUUIL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|