C25H25ClFN5O2 — CID 157201234
1-[3-[5-chloro-2-[3-fluoro-5-hydroxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]phenyl]but-3-en-2-one (PubChem CID 157201234) has the molecular formula C25H25ClFN5O2 and a molecular weight of 481.96 g/mol. Its IUPAC name is 1-[3-[5-chloro-2-[3-fluoro-5-hydroxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]phenyl]but-3-en-2-one.
| Compound Name | 1-[3-[5-chloro-2-[3-fluoro-5-hydroxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 157201234 |
| Molecular Formula | C25H25ClFN5O2 |
| Molecular Weight | 481.96 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 1-[3-[5-chloro-2-[3-fluoro-5-hydroxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cccc(-c2nc(Nc3cc(O)c(N4CCN(C)CC4)c(F)c3)ncc2Cl)c1 |
| InChI | InChI=1S/C25H25ClFN5O2/c1-3-19(33)12-16-5-4-6-17(11-16)23-20(26)15-28-25(30-23)29-18-13-21(27)24(22(34)14-18)32-9-7-31(2)8-10-32/h3-6,11,13-15,34H,1,7-10,12H2,2H3,(H,28,29,30) |
| InChIKey | UYDURGGVSFYDCZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.96 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|