C25H25ClN4O — CID 158218313
1-[3-[5-chloro-2-(4-piperidin-1-ylanilino)pyrimidin-4-yl]phenyl]but-3-en-2-one (PubChem CID 158218313) has the molecular formula C25H25ClN4O and a molecular weight of 432.96 g/mol. Its IUPAC name is 1-[3-[5-chloro-2-(4-piperidin-1-ylanilino)pyrimidin-4-yl]phenyl]but-3-en-2-one.
| Compound Name | 1-[3-[5-chloro-2-(4-piperidin-1-ylanilino)pyrimidin-4-yl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 158218313 |
| Molecular Formula | C25H25ClN4O |
| Molecular Weight | 432.96 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 1-[3-[5-chloro-2-(4-piperidin-1-ylanilino)pyrimidin-4-yl]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cccc(-c2nc(Nc3ccc(N4CCCCC4)cc3)ncc2Cl)c1 |
| InChI | InChI=1S/C25H25ClN4O/c1-2-22(31)16-18-7-6-8-19(15-18)24-23(26)17-27-25(29-24)28-20-9-11-21(12-10-20)30-13-4-3-5-14-30/h2,6-12,15,17H,1,3-5,13-14,16H2,(H,27,28,29) |
| InChIKey | YCLVFAREGVYZGY-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.96 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|