C26H24ClN5O2 — CID 147691524
1-[3-[5-chloro-2-(3-morpholin-4-ylanilino)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]but-3-en-2-one (PubChem CID 147691524) has the molecular formula C26H24ClN5O2 and a molecular weight of 473.96 g/mol. Its IUPAC name is 1-[3-[5-chloro-2-(3-morpholin-4-ylanilino)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]but-3-en-2-one.
| Compound Name | 1-[3-[5-chloro-2-(3-morpholin-4-ylanilino)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 147691524 |
| Molecular Formula | C26H24ClN5O2 |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 1-[3-[5-chloro-2-(3-morpholin-4-ylanilino)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cccc(-c2nc(Nc3cccc(N4CCOCC4)c3)nc3[nH]cc(Cl)c23)c1 |
| InChI | InChI=1S/C26H24ClN5O2/c1-2-21(33)14-17-5-3-6-18(13-17)24-23-22(27)16-28-25(23)31-26(30-24)29-19-7-4-8-20(15-19)32-9-11-34-12-10-32/h2-8,13,15-16H,1,9-12,14H2,(H2,28,29,30,31) |
| InChIKey | GRBMNGMAVVARQF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|