C37H38N6O2 — CID 158271352
4-[5-[(4-morpholin-4-ylphenyl)methyl]-2-(3-piperidin-1-ylanilino)pyrimidin-4-yl]-2-(2-oxobut-3-enyl)benzonitrile (PubChem CID 158271352) has the molecular formula C37H38N6O2 and a molecular weight of 598.75 g/mol. Its IUPAC name is 4-[5-[(4-morpholin-4-ylphenyl)methyl]-2-(3-piperidin-1-ylanilino)pyrimidin-4-yl]-2-(2-oxobut-3-enyl)benzonitrile.
| Compound Name | 4-[5-[(4-morpholin-4-ylphenyl)methyl]-2-(3-piperidin-1-ylanilino)pyrimidin-4-yl]-2-(2-oxobut-3-enyl)benzonitrile |
|---|---|
| PubChem CID | 158271352 |
| Molecular Formula | C37H38N6O2 |
| Molecular Weight | 598.75 g/mol |
| Exact Mass | 598.31 |
| IUPAC Name | 4-[5-[(4-morpholin-4-ylphenyl)methyl]-2-(3-piperidin-1-ylanilino)pyrimidin-4-yl]-2-(2-oxobut-3-enyl)benzonitrile |
| SMILES | C=CC(=O)Cc1cc(-c2nc(Nc3cccc(N4CCCCC4)c3)ncc2Cc2ccc(N3CCOCC3)cc2)ccc1C#N |
| InChI | InChI=1S/C37H38N6O2/c1-2-35(44)23-30-22-28(11-12-29(30)25-38)36-31(21-27-9-13-33(14-10-27)43-17-19-45-20-18-43)26-39-37(41-36)40-32-7-6-8-34(24-32)42-15-4-3-5-16-42/h2,6-14,22,24,26H,1,3-5,15-21,23H2,(H,39,40,41) |
| InChIKey | ACHAESFLOUHOID-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.75 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|