C33H34N4O2 — CID 158669123
1-[3-[5-benzyl-2-(3-piperidin-1-ylanilino)pyrimidin-4-yl]-5-methoxyphenyl]but-3-en-2-one (PubChem CID 158669123) has the molecular formula C33H34N4O2 and a molecular weight of 518.66 g/mol. Its IUPAC name is 1-[3-[5-benzyl-2-(3-piperidin-1-ylanilino)pyrimidin-4-yl]-5-methoxyphenyl]but-3-en-2-one.
| Compound Name | 1-[3-[5-benzyl-2-(3-piperidin-1-ylanilino)pyrimidin-4-yl]-5-methoxyphenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 158669123 |
| Molecular Formula | C33H34N4O2 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | 1-[3-[5-benzyl-2-(3-piperidin-1-ylanilino)pyrimidin-4-yl]-5-methoxyphenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cc(OC)cc(-c2nc(Nc3cccc(N4CCCCC4)c3)ncc2Cc2ccccc2)c1 |
| InChI | InChI=1S/C33H34N4O2/c1-3-30(38)19-25-18-26(21-31(20-25)39-2)32-27(17-24-11-6-4-7-12-24)23-34-33(36-32)35-28-13-10-14-29(22-28)37-15-8-5-9-16-37/h3-4,6-7,10-14,18,20-23H,1,5,8-9,15-17,19H2,2H3,(H,34,35,36) |
| InChIKey | OQEKMAQNPXUQNJ-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|