C33H32FN5 — CID 159070612
4-but-3-enyl-2-[5-[(3-fluorophenyl)methyl]-2-(3-piperidin-1-ylanilino)pyrimidin-4-yl]benzonitrile (PubChem CID 159070612) has the molecular formula C33H32FN5 and a molecular weight of 517.65 g/mol. Its IUPAC name is 4-but-3-enyl-2-[5-[(3-fluorophenyl)methyl]-2-(3-piperidin-1-ylanilino)pyrimidin-4-yl]benzonitrile.
| Compound Name | 4-but-3-enyl-2-[5-[(3-fluorophenyl)methyl]-2-(3-piperidin-1-ylanilino)pyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 159070612 |
| Molecular Formula | C33H32FN5 |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | 4-but-3-enyl-2-[5-[(3-fluorophenyl)methyl]-2-(3-piperidin-1-ylanilino)pyrimidin-4-yl]benzonitrile |
| SMILES | C=CCCc1ccc(C#N)c(-c2nc(Nc3cccc(N4CCCCC4)c3)ncc2Cc2cccc(F)c2)c1 |
| InChI | InChI=1S/C33H32FN5/c1-2-3-9-24-14-15-26(22-35)31(20-24)32-27(18-25-10-7-11-28(34)19-25)23-36-33(38-32)37-29-12-8-13-30(21-29)39-16-5-4-6-17-39/h2,7-8,10-15,19-21,23H,1,3-6,9,16-18H2,(H,36,37,38) |
| InChIKey | MCCDVRSXOGZCSZ-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|