C26H23FN6O2 — CID 118162939
N-[2-[7-fluoro-2-(4-morpholin-4-ylanilino)quinazolin-8-yl]-4-pyridinyl]prop-2-enamide (PubChem CID 118162939) has the molecular formula C26H23FN6O2 and a molecular weight of 470.51 g/mol. Its IUPAC name is N-[2-[7-fluoro-2-(4-morpholin-4-ylanilino)quinazolin-8-yl]-4-pyridinyl]prop-2-enamide.
| Compound Name | N-[2-[7-fluoro-2-(4-morpholin-4-ylanilino)quinazolin-8-yl]-4-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 118162939 |
| Molecular Formula | C26H23FN6O2 |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | N-[2-[7-fluoro-2-(4-morpholin-4-ylanilino)quinazolin-8-yl]-4-pyridinyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccnc(-c2c(F)ccc3cnc(Nc4ccc(N5CCOCC5)cc4)nc23)c1 |
| InChI | InChI=1S/C26H23FN6O2/c1-2-23(34)30-19-9-10-28-22(15-19)24-21(27)8-3-17-16-29-26(32-25(17)24)31-18-4-6-20(7-5-18)33-11-13-35-14-12-33/h2-10,15-16H,1,11-14H2,(H,28,30,34)(H,29,31,32) |
| InChIKey | BQLJWWCMFQUSGM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|