C25H22FN7O2 — CID 175012176
N-[2-[7-fluoro-2-[(6-morpholin-2-yl-3-pyridinyl)amino]quinazolin-8-yl]-4-pyridinyl]prop-2-enamide (PubChem CID 175012176) has the molecular formula C25H22FN7O2 and a molecular weight of 471.50 g/mol. Its IUPAC name is N-[2-[7-fluoro-2-[(6-morpholin-2-yl-3-pyridinyl)amino]quinazolin-8-yl]-4-pyridinyl]prop-2-enamide.
| Compound Name | N-[2-[7-fluoro-2-[(6-morpholin-2-yl-3-pyridinyl)amino]quinazolin-8-yl]-4-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 175012176 |
| Molecular Formula | C25H22FN7O2 |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | N-[2-[7-fluoro-2-[(6-morpholin-2-yl-3-pyridinyl)amino]quinazolin-8-yl]-4-pyridinyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccnc(-c2c(F)ccc3cnc(Nc4ccc(C5CNCCO5)nc4)nc23)c1 |
| InChI | InChI=1S/C25H22FN7O2/c1-2-22(34)31-16-7-8-28-20(11-16)23-18(26)5-3-15-12-30-25(33-24(15)23)32-17-4-6-19(29-13-17)21-14-27-9-10-35-21/h2-8,11-13,21,27H,1,9-10,14H2,(H,28,31,34)(H,30,32,33) |
| InChIKey | QGEQVLJUVRDVON-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 113.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|