C27H26FN7O2 — CID 175011522
N-[3-[2-[[6-[(2S)-3-(aminomethyl)morpholin-2-yl]-3-pyridinyl]amino]-7-fluoroquinazolin-8-yl]phenyl]prop-2-enamide (PubChem CID 175011522) has the molecular formula C27H26FN7O2 and a molecular weight of 499.55 g/mol. Its IUPAC name is N-[3-[2-[[6-[(2S)-3-(aminomethyl)morpholin-2-yl]-3-pyridinyl]amino]-7-fluoroquinazolin-8-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[2-[[6-[(2S)-3-(aminomethyl)morpholin-2-yl]-3-pyridinyl]amino]-7-fluoroquinazolin-8-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 175011522 |
| Molecular Formula | C27H26FN7O2 |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | N-[3-[2-[[6-[(2S)-3-(aminomethyl)morpholin-2-yl]-3-pyridinyl]amino]-7-fluoroquinazolin-8-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2c(F)ccc3cnc(Nc4ccc([C@H]5OCCNC5CN)nc4)nc23)c1 |
| InChI | InChI=1S/C27H26FN7O2/c1-2-23(36)33-18-5-3-4-16(12-18)24-20(28)8-6-17-14-32-27(35-25(17)24)34-19-7-9-21(31-15-19)26-22(13-29)30-10-11-37-26/h2-9,12,14-15,22,26,30H,1,10-11,13,29H2,(H,33,36)(H,32,34,35)/t22?,26-/m1/s1 |
| InChIKey | ZTRRWVFKGSECLQ-ZWAGFTRDSA-N |
| XLogP | 3.69 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|