C23H19N5O — CID 138463042
N-[3-[2-(4-aminoanilino)quinazolin-8-yl]phenyl]prop-2-enamide (PubChem CID 138463042) has the molecular formula C23H19N5O and a molecular weight of 381.44 g/mol. Its IUPAC name is N-[3-[2-(4-aminoanilino)quinazolin-8-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[2-(4-aminoanilino)quinazolin-8-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 138463042 |
| Molecular Formula | C23H19N5O |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N-[3-[2-(4-aminoanilino)quinazolin-8-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2cccc3cnc(Nc4ccc(N)cc4)nc23)c1 |
| InChI | InChI=1S/C23H19N5O/c1-2-21(29)26-19-7-3-5-15(13-19)20-8-4-6-16-14-25-23(28-22(16)20)27-18-11-9-17(24)10-12-18/h2-14H,1,24H2,(H,26,29)(H,25,27,28) |
| InChIKey | ZWFYJWLDGBQVNT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|