C30H31FN6O2 — CID 118163015
N-[3-[2-[3-fluoro-4-[4-[(2S)-2-hydroxypropyl]piperazin-1-yl]anilino]quinazolin-8-yl]phenyl]prop-2-enamide (PubChem CID 118163015) has the molecular formula C30H31FN6O2 and a molecular weight of 526.62 g/mol. Its IUPAC name is N-[3-[2-[3-fluoro-4-[4-[(2S)-2-hydroxypropyl]piperazin-1-yl]anilino]quinazolin-8-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[2-[3-fluoro-4-[4-[(2S)-2-hydroxypropyl]piperazin-1-yl]anilino]quinazolin-8-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118163015 |
| Molecular Formula | C30H31FN6O2 |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | N-[3-[2-[3-fluoro-4-[4-[(2S)-2-hydroxypropyl]piperazin-1-yl]anilino]quinazolin-8-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2cccc3cnc(Nc4ccc(N5CCN(C[C@H](C)O)CC5)c(F)c4)nc23)c1 |
| InChI | InChI=1S/C30H31FN6O2/c1-3-28(39)33-23-8-4-6-21(16-23)25-9-5-7-22-18-32-30(35-29(22)25)34-24-10-11-27(26(31)17-24)37-14-12-36(13-15-37)19-20(2)38/h3-11,16-18,20,38H,1,12-15,19H2,2H3,(H,33,39)(H,32,34,35)/t20-/m0/s1 |
| InChIKey | RVYJALQXLLCJCE-FQEVSTJZSA-N |
| XLogP | 4.81 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|