C24H20F2N4O — CID 175011011
8-(2,6-difluorophenyl)-N-(4-morpholin-2-ylphenyl)quinazolin-2-amine (PubChem CID 175011011) has the molecular formula C24H20F2N4O and a molecular weight of 418.45 g/mol. Its IUPAC name is 8-(2,6-difluorophenyl)-N-(4-morpholin-2-ylphenyl)quinazolin-2-amine.
| Compound Name | 8-(2,6-difluorophenyl)-N-(4-morpholin-2-ylphenyl)quinazolin-2-amine |
|---|---|
| PubChem CID | 175011011 |
| Molecular Formula | C24H20F2N4O |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 8-(2,6-difluorophenyl)-N-(4-morpholin-2-ylphenyl)quinazolin-2-amine |
| SMILES | Fc1cccc(F)c1-c1cccc2cnc(Nc3ccc(C4CNCCO4)cc3)nc12 |
| InChI | InChI=1S/C24H20F2N4O/c25-19-5-2-6-20(26)22(19)18-4-1-3-16-13-28-24(30-23(16)18)29-17-9-7-15(8-10-17)21-14-27-11-12-31-21/h1-10,13,21,27H,11-12,14H2,(H,28,29,30) |
| InChIKey | NQHVDRXXQJBCBO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |