C26H24ClN7O3 — CID 175030936
N-[2-[7-chloro-2-[(2-methoxy-6-morpholin-2-yl-3-pyridinyl)amino]quinazolin-8-yl]-4-pyridinyl]prop-2-enamide (PubChem CID 175030936) has the molecular formula C26H24ClN7O3 and a molecular weight of 517.98 g/mol. Its IUPAC name is N-[2-[7-chloro-2-[(2-methoxy-6-morpholin-2-yl-3-pyridinyl)amino]quinazolin-8-yl]-4-pyridinyl]prop-2-enamide.
| Compound Name | N-[2-[7-chloro-2-[(2-methoxy-6-morpholin-2-yl-3-pyridinyl)amino]quinazolin-8-yl]-4-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 175030936 |
| Molecular Formula | C26H24ClN7O3 |
| Molecular Weight | 517.98 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | N-[2-[7-chloro-2-[(2-methoxy-6-morpholin-2-yl-3-pyridinyl)amino]quinazolin-8-yl]-4-pyridinyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccnc(-c2c(Cl)ccc3cnc(Nc4ccc(C5CNCCO5)nc4OC)nc23)c1 |
| InChI | InChI=1S/C26H24ClN7O3/c1-3-22(35)31-16-8-9-29-20(12-16)23-17(27)5-4-15-13-30-26(34-24(15)23)33-19-7-6-18(32-25(19)36-2)21-14-28-10-11-37-21/h3-9,12-13,21,28H,1,10-11,14H2,2H3,(H,29,31,35)(H,30,33,34) |
| InChIKey | HNMAQBPWGVUYKJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 123.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.98 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|