C27H28N8O3 — CID 175010800
N-[2-[2-[[6-[(2S)-2-(aminomethyl)morpholin-2-yl]-2-methoxy-3-pyridinyl]amino]quinazolin-8-yl]-4-pyridinyl]prop-2-enamide (PubChem CID 175010800) has the molecular formula C27H28N8O3 and a molecular weight of 512.57 g/mol. Its IUPAC name is N-[2-[2-[[6-[(2S)-2-(aminomethyl)morpholin-2-yl]-2-methoxy-3-pyridinyl]amino]quinazolin-8-yl]-4-pyridinyl]prop-2-enamide.
| Compound Name | N-[2-[2-[[6-[(2S)-2-(aminomethyl)morpholin-2-yl]-2-methoxy-3-pyridinyl]amino]quinazolin-8-yl]-4-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 175010800 |
| Molecular Formula | C27H28N8O3 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | N-[2-[2-[[6-[(2S)-2-(aminomethyl)morpholin-2-yl]-2-methoxy-3-pyridinyl]amino]quinazolin-8-yl]-4-pyridinyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccnc(-c2cccc3cnc(Nc4ccc([C@]5(CN)CNCCO5)nc4OC)nc23)c1 |
| InChI | InChI=1S/C27H28N8O3/c1-3-23(36)32-18-9-10-30-21(13-18)19-6-4-5-17-14-31-26(35-24(17)19)33-20-7-8-22(34-25(20)37-2)27(15-28)16-29-11-12-38-27/h3-10,13-14,29H,1,11-12,15-16,28H2,2H3,(H,30,32,36)(H,31,33,35)/t27-/m0/s1 |
| InChIKey | GIBXVYRMVNEEAE-MHZLTWQESA-N |
| XLogP | 2.74 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|