C21H20ClN7O — CID 164911786
N-[3-[5-chloro-2-[(2,5-dimethylpyrazol-3-yl)amino]pyrimidin-4-yl]-1-methylindol-6-yl]prop-2-enamide (PubChem CID 164911786) has the molecular formula C21H20ClN7O and a molecular weight of 421.89 g/mol. Its IUPAC name is N-[3-[5-chloro-2-[(2,5-dimethylpyrazol-3-yl)amino]pyrimidin-4-yl]-1-methylindol-6-yl]prop-2-enamide.
| Compound Name | N-[3-[5-chloro-2-[(2,5-dimethylpyrazol-3-yl)amino]pyrimidin-4-yl]-1-methylindol-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 164911786 |
| Molecular Formula | C21H20ClN7O |
| Molecular Weight | 421.89 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | N-[3-[5-chloro-2-[(2,5-dimethylpyrazol-3-yl)amino]pyrimidin-4-yl]-1-methylindol-6-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc2c(-c3nc(Nc4cc(C)nn4C)ncc3Cl)cn(C)c2c1 |
| InChI | InChI=1S/C21H20ClN7O/c1-5-19(30)24-13-6-7-14-15(11-28(3)17(14)9-13)20-16(22)10-23-21(26-20)25-18-8-12(2)27-29(18)4/h5-11H,1H2,2-4H3,(H,24,30)(H,23,25,26) |
| InChIKey | MLEUANXHPBGMIL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.89 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|