C22H18ClFN6O — CID 156804690
N-[1-[2-(4-amino-3-fluoroanilino)-5-chloropyrimidin-4-yl]-3-methylindol-5-yl]prop-2-enamide (PubChem CID 156804690) has the molecular formula C22H18ClFN6O and a molecular weight of 436.88 g/mol. Its IUPAC name is N-[1-[2-(4-amino-3-fluoroanilino)-5-chloropyrimidin-4-yl]-3-methylindol-5-yl]prop-2-enamide.
| Compound Name | N-[1-[2-(4-amino-3-fluoroanilino)-5-chloropyrimidin-4-yl]-3-methylindol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 156804690 |
| Molecular Formula | C22H18ClFN6O |
| Molecular Weight | 436.88 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | N-[1-[2-(4-amino-3-fluoroanilino)-5-chloropyrimidin-4-yl]-3-methylindol-5-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc2c(c1)c(C)cn2-c1nc(Nc2ccc(N)c(F)c2)ncc1Cl |
| InChI | InChI=1S/C22H18ClFN6O/c1-3-20(31)27-13-5-7-19-15(8-13)12(2)11-30(19)21-16(23)10-26-22(29-21)28-14-4-6-18(25)17(24)9-14/h3-11H,1,25H2,2H3,(H,27,31)(H,26,28,29) |
| InChIKey | OFWWGVYMADWWOJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.88 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|