C27H28N8O3 — CID 122474629
N-[3-[2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]-5-oxopyrimido[4,5-d]pyrimidin-8-yl]phenyl]prop-2-enamide (PubChem CID 122474629) has the molecular formula C27H28N8O3 and a molecular weight of 512.57 g/mol. Its IUPAC name is N-[3-[2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]-5-oxopyrimido[4,5-d]pyrimidin-8-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]-5-oxopyrimido[4,5-d]pyrimidin-8-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122474629 |
| Molecular Formula | C27H28N8O3 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | N-[3-[2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]-5-oxopyrimido[4,5-d]pyrimidin-8-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-n2cnc(=O)c3cnc(Nc4ccc(N5CCN(CCO)CC5)cc4)nc32)c1 |
| InChI | InChI=1S/C27H28N8O3/c1-2-24(37)30-20-4-3-5-22(16-20)35-18-29-26(38)23-17-28-27(32-25(23)35)31-19-6-8-21(9-7-19)34-12-10-33(11-13-34)14-15-36/h2-9,16-18,36H,1,10-15H2,(H,30,37)(H,28,31,32) |
| InChIKey | KDPYJQREZLPUQX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|