C29H30N8O4 — CID 122475699
2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]-5-oxo-8-[3-(prop-2-enoylamino)phenyl]pyrido[2,3-d]pyrimidine-7-carboxamide (PubChem CID 122475699) has the molecular formula C29H30N8O4 and a molecular weight of 554.61 g/mol. Its IUPAC name is 2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]-5-oxo-8-[3-(prop-2-enoylamino)phenyl]pyrido[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | 2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]-5-oxo-8-[3-(prop-2-enoylamino)phenyl]pyrido[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 122475699 |
| Molecular Formula | C29H30N8O4 |
| Molecular Weight | 554.61 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | 2-[4-[4-(2-hydroxyethyl)piperazin-1-yl]anilino]-5-oxo-8-[3-(prop-2-enoylamino)phenyl]pyrido[2,3-d]pyrimidine-7-carboxamide |
| SMILES | C=CC(=O)Nc1cccc(-n2c(C(N)=O)cc(=O)c3cnc(Nc4ccc(N5CCN(CCO)CC5)cc4)nc32)c1 |
| InChI | InChI=1S/C29H30N8O4/c1-2-26(40)32-20-4-3-5-22(16-20)37-24(27(30)41)17-25(39)23-18-31-29(34-28(23)37)33-19-6-8-21(9-7-19)36-12-10-35(11-13-36)14-15-38/h2-9,16-18,38H,1,10-15H2,(H2,30,41)(H,32,40)(H,31,33,34) |
| InChIKey | BGJKXEAZWFKQPT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 158.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.61 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|