C27H26FN7O2 — CID 122475371
N-[4-fluoro-3-[2-[4-(4-methylpiperazin-1-yl)anilino]-5-oxopyrido[2,3-d]pyrimidin-8-yl]phenyl]prop-2-enamide (PubChem CID 122475371) has the molecular formula C27H26FN7O2 and a molecular weight of 499.55 g/mol. Its IUPAC name is N-[4-fluoro-3-[2-[4-(4-methylpiperazin-1-yl)anilino]-5-oxopyrido[2,3-d]pyrimidin-8-yl]phenyl]prop-2-enamide.
| Compound Name | N-[4-fluoro-3-[2-[4-(4-methylpiperazin-1-yl)anilino]-5-oxopyrido[2,3-d]pyrimidin-8-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122475371 |
| Molecular Formula | C27H26FN7O2 |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | N-[4-fluoro-3-[2-[4-(4-methylpiperazin-1-yl)anilino]-5-oxopyrido[2,3-d]pyrimidin-8-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(F)c(-n2ccc(=O)c3cnc(Nc4ccc(N5CCN(C)CC5)cc4)nc32)c1 |
| InChI | InChI=1S/C27H26FN7O2/c1-3-25(37)30-19-6-9-22(28)23(16-19)35-11-10-24(36)21-17-29-27(32-26(21)35)31-18-4-7-20(8-5-18)34-14-12-33(2)13-15-34/h3-11,16-17H,1,12-15H2,2H3,(H,30,37)(H,29,31,32) |
| InChIKey | DKYZVHMTMMNLKZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|