C30H30FN9O — CID 162660877
N-[3-[8-(4-fluoroanilino)-2-[4-(4-methylpiperazin-1-yl)anilino]purin-9-yl]phenyl]acetamide (PubChem CID 162660877) has the molecular formula C30H30FN9O and a molecular weight of 551.63 g/mol. Its IUPAC name is N-[3-[8-(4-fluoroanilino)-2-[4-(4-methylpiperazin-1-yl)anilino]purin-9-yl]phenyl]acetamide.
| Compound Name | N-[3-[8-(4-fluoroanilino)-2-[4-(4-methylpiperazin-1-yl)anilino]purin-9-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 162660877 |
| Molecular Formula | C30H30FN9O |
| Molecular Weight | 551.63 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | N-[3-[8-(4-fluoroanilino)-2-[4-(4-methylpiperazin-1-yl)anilino]purin-9-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(-n2c(Nc3ccc(F)cc3)nc3cnc(Nc4ccc(N5CCN(C)CC5)cc4)nc32)c1 |
| InChI | InChI=1S/C30H30FN9O/c1-20(41)33-24-4-3-5-26(18-24)40-28-27(36-30(40)35-23-8-6-21(31)7-9-23)19-32-29(37-28)34-22-10-12-25(13-11-22)39-16-14-38(2)15-17-39/h3-13,18-19H,14-17H2,1-2H3,(H,33,41)(H,35,36)(H,32,34,37) |
| InChIKey | AIKRQLXNJDMQKE-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 103.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.63 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|