C28H32N8O2 — CID 174783982
N-[9-cyclopentyl-2-[4-(4-methylpiperazin-1-yl)anilino]purin-8-yl]-3-hydroxybenzamide (PubChem CID 174783982) has the molecular formula C28H32N8O2 and a molecular weight of 512.62 g/mol. Its IUPAC name is N-[9-cyclopentyl-2-[4-(4-methylpiperazin-1-yl)anilino]purin-8-yl]-3-hydroxybenzamide.
| Compound Name | N-[9-cyclopentyl-2-[4-(4-methylpiperazin-1-yl)anilino]purin-8-yl]-3-hydroxybenzamide |
|---|---|
| PubChem CID | 174783982 |
| Molecular Formula | C28H32N8O2 |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | N-[9-cyclopentyl-2-[4-(4-methylpiperazin-1-yl)anilino]purin-8-yl]-3-hydroxybenzamide |
| SMILES | CN1CCN(c2ccc(Nc3ncc4nc(NC(=O)c5cccc(O)c5)n(C5CCCC5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C28H32N8O2/c1-34-13-15-35(16-14-34)21-11-9-20(10-12-21)30-27-29-18-24-25(32-27)36(22-6-2-3-7-22)28(31-24)33-26(38)19-5-4-8-23(37)17-19/h4-5,8-12,17-18,22,37H,2-3,6-7,13-16H2,1H3,(H,29,30,32)(H,31,33,38) |
| InChIKey | WBSXWPWOBCCRPG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|